Butanethioamide, N-(4-chlorophenyl)-3-oxo-
CAS No: 13806-82-1
Butane
13806-82-1
butanethioamide,chlorophenyl,butane,13806-82-1
2025-10-22 Discover Butanethioamide, N-(4-chlorophenyl)-3-oxo- (CAS No: 13806-82-1) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.